C21H24N2O5 — CID 102563648
2-(cyclopropanecarbonyl)-N-[3-(furan-2-ylmethoxymethyl)phenyl]morpholine-4-carboxamide (PubChem CID 102563648) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-(cyclopropanecarbonyl)-N-[3-(furan-2-ylmethoxymethyl)phenyl]morpholine-4-carboxamide.
| Compound Name | 2-(cyclopropanecarbonyl)-N-[3-(furan-2-ylmethoxymethyl)phenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 102563648 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-(cyclopropanecarbonyl)-N-[3-(furan-2-ylmethoxymethyl)phenyl]morpholine-4-carboxamide |
| SMILES | O=C(C1CC1)C1CN(C(=O)Nc2cccc(COCc3ccco3)c2)CCO1 |
| InChI | InChI=1S/C21H24N2O5/c24-20(16-6-7-16)19-12-23(8-10-28-19)21(25)22-17-4-1-3-15(11-17)13-26-14-18-5-2-9-27-18/h1-5,9,11,16,19H,6-8,10,12-14H2,(H,22,25) |
| InChIKey | ACIQDKODIHRPKM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |