C22H29N3O4 — CID 55819679
1-[3-(furan-2-ylmethoxymethyl)phenyl]-3-[1-(2-methylpropanoyl)piperidin-4-yl]urea (PubChem CID 55819679) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 1-[3-(furan-2-ylmethoxymethyl)phenyl]-3-[1-(2-methylpropanoyl)piperidin-4-yl]urea.
| Compound Name | 1-[3-(furan-2-ylmethoxymethyl)phenyl]-3-[1-(2-methylpropanoyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 55819679 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 1-[3-(furan-2-ylmethoxymethyl)phenyl]-3-[1-(2-methylpropanoyl)piperidin-4-yl]urea |
| SMILES | CC(C)C(=O)N1CCC(NC(=O)Nc2cccc(COCc3ccco3)c2)CC1 |
| InChI | InChI=1S/C22H29N3O4/c1-16(2)21(26)25-10-8-18(9-11-25)23-22(27)24-19-6-3-5-17(13-19)14-28-15-20-7-4-12-29-20/h3-7,12-13,16,18H,8-11,14-15H2,1-2H3,(H2,23,24,27) |
| InChIKey | QPVZCUAQGGSELF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |