C12H17BrN4O — CID 102563881
(5-bromopyrimidin-4-yl)-[3-(dimethylamino)piperidin-1-yl]methanone (PubChem CID 102563881) has the molecular formula C12H17BrN4O and a molecular weight of 313.20 g/mol. Its IUPAC name is (5-bromopyrimidin-4-yl)-[3-(dimethylamino)piperidin-1-yl]methanone.
| Compound Name | (5-bromopyrimidin-4-yl)-[3-(dimethylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 102563881 |
| Molecular Formula | C12H17BrN4O |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (5-bromopyrimidin-4-yl)-[3-(dimethylamino)piperidin-1-yl]methanone |
| SMILES | CN(C)C1CCCN(C(=O)c2ncncc2Br)C1 |
| InChI | InChI=1S/C12H17BrN4O/c1-16(2)9-4-3-5-17(7-9)12(18)11-10(13)6-14-8-15-11/h6,8-9H,3-5,7H2,1-2H3 |
| InChIKey | UYDYDWZEGHZCAE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |