C11H15NO4S — CID 102567490
ethyl 1-cyano-2-methylidene-4-methylsulfonylcyclopentane-1-carboxylate (PubChem CID 102567490) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is ethyl 1-cyano-2-methylidene-4-methylsulfonylcyclopentane-1-carboxylate.
| Compound Name | ethyl 1-cyano-2-methylidene-4-methylsulfonylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 102567490 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | ethyl 1-cyano-2-methylidene-4-methylsulfonylcyclopentane-1-carboxylate |
| SMILES | C=C1CC(S(C)(=O)=O)CC1(C#N)C(=O)OCC |
| InChI | InChI=1S/C11H15NO4S/c1-4-16-10(13)11(7-12)6-9(5-8(11)2)17(3,14)15/h9H,2,4-6H2,1,3H3 |
| InChIKey | QWTLAJPVMUATFL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|