C21H35NO3Si — CID 10809622
ethyl (1R,5R)-1-cyano-4,5-dimethyl-2-oxo-3-tri(propan-2-yl)silylcyclohex-3-ene-1-carboxylate (PubChem CID 10809622) has the molecular formula C21H35NO3Si and a molecular weight of 377.60 g/mol. Its IUPAC name is ethyl (1R,5R)-1-cyano-4,5-dimethyl-2-oxo-3-tri(propan-2-yl)silylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,5R)-1-cyano-4,5-dimethyl-2-oxo-3-tri(propan-2-yl)silylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10809622 |
| Molecular Formula | C21H35NO3Si |
| Molecular Weight | 377.60 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | ethyl (1R,5R)-1-cyano-4,5-dimethyl-2-oxo-3-tri(propan-2-yl)silylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C#N)C[C@@H](C)C(C)=C([Si](C(C)C)(C(C)C)C(C)C)C1=O |
| InChI | InChI=1S/C21H35NO3Si/c1-10-25-20(24)21(12-22)11-16(8)17(9)18(19(21)23)26(13(2)3,14(4)5)15(6)7/h13-16H,10-11H2,1-9H3/t16-,21-/m1/s1 |
| InChIKey | HGGKLRUMCYRJCK-IIBYNOLFSA-N |
| XLogP | 5.20 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|