About 4,4-dioxo-4λ6-thiatricyclo[5.3.0.02,6]decane-9-carboxylic acid
4,4-dioxo-4λ6-thiatricyclo[5.3.0.02,6]decane-9-carboxylic acid (PubChem CID 102567562) has the molecular formula C10H14O4S
and a molecular weight of 230.28 g/mol. Its IUPAC name is 4,4-dioxo-4λ6-thiatricyclo[5.3.0.02,6]decane-9-carboxylic acid.
Analyze 4,4-dioxo-4λ6-thiatricyclo[5.3.0.02,6]decane-9-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dioxo-4λ6-thiatricyclo[5.3.0.02,6]decane-9-carboxylic acid?
The IUPAC name of 4,4-dioxo-4λ6-thiatricyclo[5.3.0.02,6]decane-9-carboxylic acid (CID 102567562) is 4,4-dioxo-4λ6-thiatricyclo[5.3.0.02,6]decane-9-carboxylic acid.
What is the SMILES notation for 4,4-dioxo-4λ6-thiatricyclo[5.3.0.02,6]decane-9-carboxylic acid?
The canonical SMILES for 4,4-dioxo-4λ6-thiatricyclo[5.3.0.02,6]decane-9-carboxylic acid is O=C(O)C1CC2C(C1)C1CS(=O)(=O)CC21.
What is the InChIKey of 4,4-dioxo-4λ6-thiatricyclo[5.3.0.02,6]decane-9-carboxylic acid?
The InChIKey is WXZLNOKHNVDEDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4S/c11-10(12)5-1-6-7(2-5)9-4-15(13,14)3-8(6)9/h5-9H,1-4H2,(H,11,12).
What are the key properties of 4,4-dioxo-4λ6-thiatricyclo[5.3.0.02,6]decane-9-carboxylic acid?
4,4-dioxo-4λ6-thiatricyclo[5.3.0.02,6]decane-9-carboxylic acid has a molecular weight of 230.28 g/mol, XLogP of 0.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dioxo-4λ6-thiatricyclo[5.3.0.02,6]decane-9-carboxylic acid is sourced from PubChem (CID 102567562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).