methyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate

C11H20O4 — CID 102568725

IUPACmethyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate
SMILESCOC(=O)C1(C)CC(C)C(OC)(OC)C1
InChIInChI=1S/C11H20O4/c1-8-6-10(2,9(12)13-3)7-11(8,14-4)15-5/h8H,6-7H2,1-5H3
InChIKeyLCHHFKPTCILQLP-UHFFFAOYSA-N
MW216.28 g/mol
LogP1.58
Rot. Bonds3

About methyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate

methyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate (PubChem CID 102568725) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is methyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate.

Molecular Properties

Compound Namemethyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate
PubChem CID102568725
Molecular FormulaC11H20O4
Molecular Weight216.28 g/mol
Exact Mass216.14
IUPAC Namemethyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate
SMILESCOC(=O)C1(C)CC(C)C(OC)(OC)C1
InChIInChI=1S/C11H20O4/c1-8-6-10(2,9(12)13-3)7-11(8,14-4)15-5/h8H,6-7H2,1-5H3
InChIKeyLCHHFKPTCILQLP-UHFFFAOYSA-N
XLogP1.58
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.28
LogP ≤ 51.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze methyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate?
The IUPAC name of methyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate (CID 102568725) is methyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate.
What is the SMILES notation for methyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate?
The canonical SMILES for methyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate is COC(=O)C1(C)CC(C)C(OC)(OC)C1.
What is the InChIKey of methyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate?
The InChIKey is LCHHFKPTCILQLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-8-6-10(2,9(12)13-3)7-11(8,14-4)15-5/h8H,6-7H2,1-5H3.
What are the key properties of methyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate?
methyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate has a molecular weight of 216.28 g/mol, XLogP of 1.58, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,3-dimethoxy-1,4-dimethylcyclopentane-1-carboxylate is sourced from PubChem (CID 102568725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).