C7H12O5S — CID 102568948
2-ethylsulfonyl-1-(hydroxymethyl)cyclopropane-1-carboxylic acid (PubChem CID 102568948) has the molecular formula C7H12O5S and a molecular weight of 208.23 g/mol. Its IUPAC name is 2-ethylsulfonyl-1-(hydroxymethyl)cyclopropane-1-carboxylic acid.
| Compound Name | 2-ethylsulfonyl-1-(hydroxymethyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 102568948 |
| Molecular Formula | C7H12O5S |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 2-ethylsulfonyl-1-(hydroxymethyl)cyclopropane-1-carboxylic acid |
| SMILES | CCS(=O)(=O)C1CC1(CO)C(=O)O |
| InChI | InChI=1S/C7H12O5S/c1-2-13(11,12)5-3-7(5,4-8)6(9)10/h5,8H,2-4H2,1H3,(H,9,10) |
| InChIKey | CLKWFBHKZZFHJM-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |