trans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid

C6H10O4 — CID 70114755

IUPACtrans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid
SMILESO=C(O)[C@@]1(CO)C[C@H]1CO
InChIInChI=1S/C6H10O4/c7-2-4-1-6(4,3-8)5(9)10/h4,7-8H,1-3H2,(H,9,10)/t4-,6+/m0/s1
InChIKeyCERCEHCGKDSLJS-UJURSFKZSA-N
MW146.14 g/mol
LogP-0.94
Rot. Bonds3

About trans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid

trans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid (PubChem CID 70114755) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is trans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid.

Molecular Properties

Compound Nametrans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid
PubChem CID70114755
Molecular FormulaC6H10O4
Molecular Weight146.14 g/mol
Exact Mass146.06
IUPAC Nametrans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid
SMILESO=C(O)[C@@]1(CO)C[C@H]1CO
InChIInChI=1S/C6H10O4/c7-2-4-1-6(4,3-8)5(9)10/h4,7-8H,1-3H2,(H,9,10)/t4-,6+/m0/s1
InChIKeyCERCEHCGKDSLJS-UJURSFKZSA-N
XLogP-0.94
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.14
LogP ≤ 5-0.94
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze trans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid?
The IUPAC name of trans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid (CID 70114755) is trans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for trans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid?
The canonical SMILES for trans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid is O=C(O)[C@@]1(CO)C[C@H]1CO.
What is the InChIKey of trans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid?
The InChIKey is CERCEHCGKDSLJS-UJURSFKZSA-N. The full InChI is InChI=1S/C6H10O4/c7-2-4-1-6(4,3-8)5(9)10/h4,7-8H,1-3H2,(H,9,10)/t4-,6+/m0/s1.
What are the key properties of trans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid?
trans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid has a molecular weight of 146.14 g/mol, XLogP of -0.94, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2R)-1,2-bis(hydroxymethyl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 70114755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).