C25H28N10O3S — CID 10256947
5-N-[2-(diaminomethylideneamino)ethyl]-2-N-[2-[2-(diaminomethylideneamino)ethylcarbamoyl]-1-benzothiophen-5-yl]-1H-indole-2,5-dicarboxamide (PubChem CID 10256947) has the molecular formula C25H28N10O3S and a molecular weight of 548.63 g/mol. Its IUPAC name is 5-N-[2-(diaminomethylideneamino)ethyl]-2-N-[2-[2-(diaminomethylideneamino)ethylcarbamoyl]-1-benzothiophen-5-yl]-1H-indole-2,5-dicarboxamide.
| Compound Name | 5-N-[2-(diaminomethylideneamino)ethyl]-2-N-[2-[2-(diaminomethylideneamino)ethylcarbamoyl]-1-benzothiophen-5-yl]-1H-indole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 10256947 |
| Molecular Formula | C25H28N10O3S |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 5-N-[2-(diaminomethylideneamino)ethyl]-2-N-[2-[2-(diaminomethylideneamino)ethylcarbamoyl]-1-benzothiophen-5-yl]-1H-indole-2,5-dicarboxamide |
| SMILES | NC(N)=NCCNC(=O)c1ccc2[nH]c(C(=O)Nc3ccc4sc(C(=O)NCCN=C(N)N)cc4c3)cc2c1 |
| InChI | InChI=1S/C25H28N10O3S/c26-24(27)32-7-5-30-21(36)13-1-3-17-14(9-13)11-18(35-17)22(37)34-16-2-4-19-15(10-16)12-20(39-19)23(38)31-6-8-33-25(28)29/h1-4,9-12,35H,5-8H2,(H,30,36)(H,31,38)(H,34,37)(H4,26,27,32)(H4,28,29,33) |
| InChIKey | IYEJZHCRSPOYLA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 231.89 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|