C27H33N9O3 — CID 142877490
5-N-(2-aminoethyl)-2-N-[2-[2-[(N-ethyl-N'-methylcarbamimidoyl)amino]ethylcarbamoyl]-1H-indol-5-yl]-1H-indole-2,5-dicarboxamide (PubChem CID 142877490) has the molecular formula C27H33N9O3 and a molecular weight of 531.62 g/mol. Its IUPAC name is 5-N-(2-aminoethyl)-2-N-[2-[2-[(N-ethyl-N'-methylcarbamimidoyl)amino]ethylcarbamoyl]-1H-indol-5-yl]-1H-indole-2,5-dicarboxamide.
| Compound Name | 5-N-(2-aminoethyl)-2-N-[2-[2-[(N-ethyl-N'-methylcarbamimidoyl)amino]ethylcarbamoyl]-1H-indol-5-yl]-1H-indole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 142877490 |
| Molecular Formula | C27H33N9O3 |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 5-N-(2-aminoethyl)-2-N-[2-[2-[(N-ethyl-N'-methylcarbamimidoyl)amino]ethylcarbamoyl]-1H-indol-5-yl]-1H-indole-2,5-dicarboxamide |
| SMILES | CCN/C(=N\C)NCCNC(=O)c1cc2cc(NC(=O)c3cc4cc(C(=O)NCCN)ccc4[nH]3)ccc2[nH]1 |
| InChI | InChI=1S/C27H33N9O3/c1-3-30-27(29-2)33-11-10-32-25(38)22-15-18-13-19(5-7-21(18)35-22)34-26(39)23-14-17-12-16(4-6-20(17)36-23)24(37)31-9-8-28/h4-7,12-15,35-36H,3,8-11,28H2,1-2H3,(H,31,37)(H,32,38)(H,34,39)(H2,29,30,33) |
| InChIKey | WRSPGIPJHQMTNO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 181.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|