C25H31N9O2 — CID 142877506
N-(2-aminoethyl)-2-[[[2-[3-(diaminomethylideneamino)propylcarbamoyl]-1H-indol-6-yl]amino]methyl]-1H-indole-5-carboxamide (PubChem CID 142877506) has the molecular formula C25H31N9O2 and a molecular weight of 489.58 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[[[2-[3-(diaminomethylideneamino)propylcarbamoyl]-1H-indol-6-yl]amino]methyl]-1H-indole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-[[[2-[3-(diaminomethylideneamino)propylcarbamoyl]-1H-indol-6-yl]amino]methyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 142877506 |
| Molecular Formula | C25H31N9O2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | N-(2-aminoethyl)-2-[[[2-[3-(diaminomethylideneamino)propylcarbamoyl]-1H-indol-6-yl]amino]methyl]-1H-indole-5-carboxamide |
| SMILES | NCCNC(=O)c1ccc2[nH]c(CNc3ccc4cc(C(=O)NCCCN=C(N)N)[nH]c4c3)cc2c1 |
| InChI | InChI=1S/C25H31N9O2/c26-6-9-30-23(35)16-3-5-20-17(10-16)11-19(33-20)14-32-18-4-2-15-12-22(34-21(15)13-18)24(36)29-7-1-8-31-25(27)28/h2-5,10-13,32-34H,1,6-9,14,26H2,(H,29,36)(H,30,35)(H4,27,28,31) |
| InChIKey | YBIIODQKVKYOFG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 192.23 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|