C42H51N13O6 — CID 67550216
2-N,5-N-bis[2-[2-[[(2S)-2,5-diaminopentanoyl]amino]ethylcarbamoyl]-1H-indol-6-yl]-1H-indole-2,5-dicarboxamide (PubChem CID 67550216) has the molecular formula C42H51N13O6 and a molecular weight of 833.96 g/mol. Its IUPAC name is 2-N,5-N-bis[2-[2-[[(2S)-2,5-diaminopentanoyl]amino]ethylcarbamoyl]-1H-indol-6-yl]-1H-indole-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[2-[2-[[(2S)-2,5-diaminopentanoyl]amino]ethylcarbamoyl]-1H-indol-6-yl]-1H-indole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 67550216 |
| Molecular Formula | C42H51N13O6 |
| Molecular Weight | 833.96 g/mol |
| Exact Mass | 833.41 |
| IUPAC Name | 2-N,5-N-bis[2-[2-[[(2S)-2,5-diaminopentanoyl]amino]ethylcarbamoyl]-1H-indol-6-yl]-1H-indole-2,5-dicarboxamide |
| SMILES | NCCC[C@H](N)C(=O)NCCNC(=O)c1cc2ccc(NC(=O)c3ccc4[nH]c(C(=O)Nc5ccc6cc(C(=O)NCCNC(=O)[C@@H](N)CCCN)[nH]c6c5)cc4c3)cc2[nH]1 |
| InChI | InChI=1S/C42H51N13O6/c43-11-1-3-29(45)38(57)47-13-15-49-40(59)34-18-23-5-8-27(21-32(23)54-34)51-37(56)25-7-10-31-26(17-25)20-36(53-31)42(61)52-28-9-6-24-19-35(55-33(24)22-28)41(60)50-16-14-48-39(58)30(46)4-2-12-44/h5-10,17-22,29-30,53-55H,1-4,11-16,43-46H2,(H,47,57)(H,48,58)(H,49,59)(H,50,60)(H,51,56)(H,52,61)/t29-,30-/m0/s1 |
| InChIKey | YZXPJVZFUAXADP-KYJUHHDHSA-N |
| XLogP | 1.46 |
| TPSA | 326.05 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.96 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|