C6Cl2F3- — CID 102573381
2,4-dichloro-1,3,5-trifluorobenzene-6-ide (PubChem CID 102573381) has the molecular formula C6Cl2F3- and a molecular weight of 199.97 g/mol. Its IUPAC name is 2,4-dichloro-1,3,5-trifluorobenzene-6-ide.
| Compound Name | 2,4-dichloro-1,3,5-trifluorobenzene-6-ide |
|---|---|
| PubChem CID | 102573381 |
| Molecular Formula | C6Cl2F3- |
| Molecular Weight | 199.97 g/mol |
| Exact Mass | 198.93 |
| IUPAC Name | 2,4-dichloro-1,3,5-trifluorobenzene-6-ide |
| SMILES | Fc1[c-]c(F)c(Cl)c(F)c1Cl |
| InChI | InChI=1S/C6Cl2F3/c7-4-2(9)1-3(10)5(8)6(4)11/q-1 |
| InChIKey | XIXOTVIDDDJGST-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.97 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|