C22H23NOS — CID 102573673
4-[(Z)-2-methylsulfanyl-1,5-diphenylpent-1-en-4-yn-3-yl]morpholine (PubChem CID 102573673) has the molecular formula C22H23NOS and a molecular weight of 349.50 g/mol. Its IUPAC name is 4-[(Z)-2-methylsulfanyl-1,5-diphenylpent-1-en-4-yn-3-yl]morpholine.
| Compound Name | 4-[(Z)-2-methylsulfanyl-1,5-diphenylpent-1-en-4-yn-3-yl]morpholine |
|---|---|
| PubChem CID | 102573673 |
| Molecular Formula | C22H23NOS |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 4-[(Z)-2-methylsulfanyl-1,5-diphenylpent-1-en-4-yn-3-yl]morpholine |
| SMILES | CS/C(=C\c1ccccc1)C(C#Cc1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C22H23NOS/c1-25-22(18-20-10-6-3-7-11-20)21(23-14-16-24-17-15-23)13-12-19-8-4-2-5-9-19/h2-11,18,21H,14-17H2,1H3/b22-18- |
| InChIKey | SGBAHRPNCYEWSG-PYCFMQQDSA-N |
| XLogP | 4.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|