C21H25NO — CID 132547689
4-(1-cyclohexyl-5-phenylpenta-1,4-diyn-3-yl)morpholine (PubChem CID 132547689) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is 4-(1-cyclohexyl-5-phenylpenta-1,4-diyn-3-yl)morpholine.
| Compound Name | 4-(1-cyclohexyl-5-phenylpenta-1,4-diyn-3-yl)morpholine |
|---|---|
| PubChem CID | 132547689 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 4-(1-cyclohexyl-5-phenylpenta-1,4-diyn-3-yl)morpholine |
| SMILES | C(#CC(C#CC1CCCCC1)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO/c1-3-7-19(8-4-1)11-13-21(22-15-17-23-18-16-22)14-12-20-9-5-2-6-10-20/h1,3-4,7-8,20-21H,2,5-6,9-10,15-18H2 |
| InChIKey | KYZRUMIXUCGMEF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|