C34H26O13 — CID 102574982
7-methoxy-3-(2-oxochromen-7-yl)oxy-8-[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-8-yl]chromen-2-one (PubChem CID 102574982) has the molecular formula C34H26O13 and a molecular weight of 642.57 g/mol. Its IUPAC name is 7-methoxy-3-(2-oxochromen-7-yl)oxy-8-[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-8-yl]chromen-2-one.
| Compound Name | 7-methoxy-3-(2-oxochromen-7-yl)oxy-8-[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-8-yl]chromen-2-one |
|---|---|
| PubChem CID | 102574982 |
| Molecular Formula | C34H26O13 |
| Molecular Weight | 642.57 g/mol |
| Exact Mass | 642.14 |
| IUPAC Name | 7-methoxy-3-(2-oxochromen-7-yl)oxy-8-[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-8-yl]chromen-2-one |
| SMILES | COc1ccc2cc(Oc3ccc4ccc(=O)oc4c3)c(=O)oc2c1-c1c(O[C@@H]2O[C@H](C)[C@H](O)[C@H](O)[C@H]2O)ccc2ccc(=O)oc12 |
| InChI | InChI=1S/C34H26O13/c1-15-28(37)29(38)30(39)34(42-15)45-21-10-4-17-7-12-25(36)46-31(17)27(21)26-20(41-2)9-5-18-13-23(33(40)47-32(18)26)43-19-8-3-16-6-11-24(35)44-22(16)14-19/h3-15,28-30,34,37-39H,1-2H3/t15-,28+,29+,30-,34+/m1/s1 |
| InChIKey | FWLKQNUTDHNJKM-SRMVNXEDSA-N |
| XLogP | 3.68 |
| TPSA | 188.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|