C17H40OSi4 — CID 102576649
1-[(E)-2-tris(trimethylsilyl)silylethenyl]cyclohexan-1-ol (PubChem CID 102576649) has the molecular formula C17H40OSi4 and a molecular weight of 372.85 g/mol. Its IUPAC name is 1-[(E)-2-tris(trimethylsilyl)silylethenyl]cyclohexan-1-ol.
| Compound Name | 1-[(E)-2-tris(trimethylsilyl)silylethenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102576649 |
| Molecular Formula | C17H40OSi4 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 1-[(E)-2-tris(trimethylsilyl)silylethenyl]cyclohexan-1-ol |
| SMILES | C[Si](C)(C)[Si](/C=C/C1(O)CCCCC1)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C17H40OSi4/c1-19(2,3)22(20(4,5)6,21(7,8)9)16-15-17(18)13-11-10-12-14-17/h15-16,18H,10-14H2,1-9H3/b16-15+ |
| InChIKey | RHILAYDYZUSAJH-FOCLMDBBSA-N |
| XLogP | 5.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|