About 1-ethenylcyclohexan-1-ol;ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;platinum
1-ethenylcyclohexan-1-ol;ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;platinum (PubChem CID 153498721) has the molecular formula C16H29O2PtSi2-3
and a molecular weight of 504.66 g/mol. Its IUPAC name is 1-ethenylcyclohexan-1-ol;ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;platinum.
Molecular Properties
| Compound Name | 1-ethenylcyclohexan-1-ol;ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;platinum |
| PubChem CID | 153498721 |
| Molecular Formula | C16H29O2PtSi2-3 |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 1-ethenylcyclohexan-1-ol;ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;platinum |
| SMILES | C=[C-]C1(O)CCCCC1.[H]/[C-]=C/[Si](C)(C)O[Si](C)(C)/C=[C-]/[H].[Pt] |
| InChI | InChI=1S/C8H16OSi2.C8H13O.Pt/c1-7-10(3,4)9-11(5,6)8-2;1-2-8(9)6-4-3-5-7-8;/h1-2,7-8H,3-6H3;9H,1,3-7H2;/q-2;-1; |
| InChIKey | NVTYPNGPDHOPDI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenylcyclohexan-1-ol;ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylcyclohexan-1-ol;ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;platinum?
The IUPAC name of 1-ethenylcyclohexan-1-ol;ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;platinum (CID 153498721) is 1-ethenylcyclohexan-1-ol;ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;platinum.
What is the SMILES notation for 1-ethenylcyclohexan-1-ol;ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;platinum?
The canonical SMILES for 1-ethenylcyclohexan-1-ol;ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;platinum is C=[C-]C1(O)CCCCC1.[H]/[C-]=C/[Si](C)(C)O[Si](C)(C)/C=[C-]/[H].[Pt].
What is the InChIKey of 1-ethenylcyclohexan-1-ol;ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;platinum?
The InChIKey is NVTYPNGPDHOPDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16OSi2.C8H13O.Pt/c1-7-10(3,4)9-11(5,6)8-2;1-2-8(9)6-4-3-5-7-8;/h1-2,7-8H,3-6H3;9H,1,3-7H2;/q-2;-1;.
What are the key properties of 1-ethenylcyclohexan-1-ol;ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;platinum?
1-ethenylcyclohexan-1-ol;ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;platinum has a molecular weight of 504.66 g/mol, XLogP of 4.14, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylcyclohexan-1-ol;ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;platinum is sourced from PubChem (CID 153498721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).