C40H40O4S4 — CID 102578387
1-[11,17,23-tri(ethanethioyl)-25,26,27,28-tetramethoxy-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl]ethanethione (PubChem CID 102578387) has the molecular formula C40H40O4S4 and a molecular weight of 713.02 g/mol. Its IUPAC name is 1-[11,17,23-tri(ethanethioyl)-25,26,27,28-tetramethoxy-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl]ethanethione.
| Compound Name | 1-[11,17,23-tri(ethanethioyl)-25,26,27,28-tetramethoxy-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl]ethanethione |
|---|---|
| PubChem CID | 102578387 |
| Molecular Formula | C40H40O4S4 |
| Molecular Weight | 713.02 g/mol |
| Exact Mass | 712.18 |
| IUPAC Name | 1-[11,17,23-tri(ethanethioyl)-25,26,27,28-tetramethoxy-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl]ethanethione |
| SMILES | COc1c2cc(C(C)=S)cc1Cc1cc(C(C)=S)cc(c1OC)Cc1cc(C(C)=S)cc(c1OC)Cc1cc(C(C)=S)cc(c1OC)C2 |
| InChI | InChI=1S/C40H40O4S4/c1-21(45)25-9-29-17-31-11-26(22(2)46)13-33(38(31)42-6)19-35-15-28(24(4)48)16-36(40(35)44-8)20-34-14-27(23(3)47)12-32(39(34)43-7)18-30(10-25)37(29)41-5/h9-16H,17-20H2,1-8H3 |
| InChIKey | ZIECRADTPXBKIT-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.02 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|