C33H52N3O5P — CID 10258044
(2S,5S)-1-benzoyl-2-tert-butyl-5-[(4R)-4-diethoxyphosphoryl-4-[(E)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butyl]-3-methylimidazolidin-4-one (PubChem CID 10258044) has the molecular formula C33H52N3O5P and a molecular weight of 601.77 g/mol. Its IUPAC name is (2S,5S)-1-benzoyl-2-tert-butyl-5-[(4R)-4-diethoxyphosphoryl-4-[(E)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butyl]-3-methylimidazolidin-4-one.
| Compound Name | (2S,5S)-1-benzoyl-2-tert-butyl-5-[(4R)-4-diethoxyphosphoryl-4-[(E)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butyl]-3-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 10258044 |
| Molecular Formula | C33H52N3O5P |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | (2S,5S)-1-benzoyl-2-tert-butyl-5-[(4R)-4-diethoxyphosphoryl-4-[(E)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butyl]-3-methylimidazolidin-4-one |
| SMILES | CCOP(=O)(OCC)[C@H](CCC[C@H]1C(=O)N(C)[C@H](C(C)(C)C)N1C(=O)c1ccccc1)/N=C1\C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C33H52N3O5P/c1-10-40-42(39,41-11-2)27(34-26-22-24-20-21-33(26,8)32(24,6)7)19-15-18-25-29(38)35(9)30(31(3,4)5)36(25)28(37)23-16-13-12-14-17-23/h12-14,16-17,24-25,27,30H,10-11,15,18-22H2,1-9H3/b34-26+/t24-,25+,27-,30+,33+/m1/s1 |
| InChIKey | SANAQEHWOOHAMK-NQJXLTBKSA-N |
| XLogP | 7.39 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|