C23H14Cl2N4 — CID 102581752
(2E)-2-[3,6-bis(4-chlorophenyl)-2-pyridin-2-ylpyrimidin-4-ylidene]acetonitrile (PubChem CID 102581752) has the molecular formula C23H14Cl2N4 and a molecular weight of 417.30 g/mol. Its IUPAC name is (2E)-2-[3,6-bis(4-chlorophenyl)-2-pyridin-2-ylpyrimidin-4-ylidene]acetonitrile.
| Compound Name | (2E)-2-[3,6-bis(4-chlorophenyl)-2-pyridin-2-ylpyrimidin-4-ylidene]acetonitrile |
|---|---|
| PubChem CID | 102581752 |
| Molecular Formula | C23H14Cl2N4 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | (2E)-2-[3,6-bis(4-chlorophenyl)-2-pyridin-2-ylpyrimidin-4-ylidene]acetonitrile |
| SMILES | N#C/C=C1\C=C(c2ccc(Cl)cc2)N=C(c2ccccn2)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H14Cl2N4/c24-17-6-4-16(5-7-17)22-15-20(12-13-26)29(19-10-8-18(25)9-11-19)23(28-22)21-3-1-2-14-27-21/h1-12,14-15H/b20-12+ |
| InChIKey | MPEZTFVVUAVKFY-UDWIEESQSA-N |
| XLogP | 6.10 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|