C21H35BrO5Si — CID 102582669
methyl 7-[2-(2-bromoprop-2-enyl)oxiran-2-yl]-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-3-oxoheptanoate (PubChem CID 102582669) has the molecular formula C21H35BrO5Si and a molecular weight of 475.50 g/mol. Its IUPAC name is methyl 7-[2-(2-bromoprop-2-enyl)oxiran-2-yl]-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-3-oxoheptanoate.
| Compound Name | methyl 7-[2-(2-bromoprop-2-enyl)oxiran-2-yl]-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-3-oxoheptanoate |
|---|---|
| PubChem CID | 102582669 |
| Molecular Formula | C21H35BrO5Si |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | methyl 7-[2-(2-bromoprop-2-enyl)oxiran-2-yl]-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-3-oxoheptanoate |
| SMILES | C=C(Br)CC1(C(CC(=C)C(C)C(=O)CC(=O)OC)O[Si](C)(C)C(C)(C)C)CO1 |
| InChI | InChI=1S/C21H35BrO5Si/c1-14(16(3)17(23)11-19(24)25-7)10-18(21(13-26-21)12-15(2)22)27-28(8,9)20(4,5)6/h16,18H,1-2,10-13H2,3-9H3 |
| InChIKey | RLZZELFNFFLCBW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|