C27H51BrO5Si2 — CID 101100792
methyl (3R,4R,7S)-7-[(2R,3R)-3-(2-bromoprop-2-enyl)oxiran-2-yl]-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-3-triethylsilyloxyheptanoate (PubChem CID 101100792) has the molecular formula C27H51BrO5Si2 and a molecular weight of 591.78 g/mol. Its IUPAC name is methyl (3R,4R,7S)-7-[(2R,3R)-3-(2-bromoprop-2-enyl)oxiran-2-yl]-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-3-triethylsilyloxyheptanoate.
| Compound Name | methyl (3R,4R,7S)-7-[(2R,3R)-3-(2-bromoprop-2-enyl)oxiran-2-yl]-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-3-triethylsilyloxyheptanoate |
|---|---|
| PubChem CID | 101100792 |
| Molecular Formula | C27H51BrO5Si2 |
| Molecular Weight | 591.78 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | methyl (3R,4R,7S)-7-[(2R,3R)-3-(2-bromoprop-2-enyl)oxiran-2-yl]-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-3-triethylsilyloxyheptanoate |
| SMILES | C=C(Br)C[C@H]1O[C@H]1[C@H](CC(=C)[C@@H](C)[C@@H](CC(=O)OC)O[Si](CC)(CC)CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H51BrO5Si2/c1-13-35(14-2,15-3)33-22(18-25(29)30-10)21(6)19(4)16-24(26-23(31-26)17-20(5)28)32-34(11,12)27(7,8)9/h21-24,26H,4-5,13-18H2,1-3,6-12H3/t21-,22-,23-,24+,26-/m1/s1 |
| InChIKey | RQPPGFQLTZJFHE-FYAAGUIMSA-N |
| XLogP | 7.98 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.78 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|