C30H48O5Si — CID 138977976
[(4S)-4,5-dimethylhexa-1,5-dien-3-yl] (4S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-7-[(2S,3R)-3-(2-methylidenebut-3-enyl)oxiran-2-yl]-3-oxoheptanoate (PubChem CID 138977976) has the molecular formula C30H48O5Si and a molecular weight of 516.80 g/mol. Its IUPAC name is [(4S)-4,5-dimethylhexa-1,5-dien-3-yl] (4S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-7-[(2S,3R)-3-(2-methylidenebut-3-enyl)oxiran-2-yl]-3-oxoheptanoate.
| Compound Name | [(4S)-4,5-dimethylhexa-1,5-dien-3-yl] (4S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-7-[(2S,3R)-3-(2-methylidenebut-3-enyl)oxiran-2-yl]-3-oxoheptanoate |
|---|---|
| PubChem CID | 138977976 |
| Molecular Formula | C30H48O5Si |
| Molecular Weight | 516.80 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | [(4S)-4,5-dimethylhexa-1,5-dien-3-yl] (4S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-7-[(2S,3R)-3-(2-methylidenebut-3-enyl)oxiran-2-yl]-3-oxoheptanoate |
| SMILES | C=CC(=C)C[C@H]1O[C@@H]1[C@@H](CC(=C)[C@H](C)C(=O)CC(=O)OC(C=C)[C@@H](C)C(=C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H48O5Si/c1-14-20(5)16-26-29(34-26)27(35-36(12,13)30(9,10)11)17-21(6)23(8)24(31)18-28(32)33-25(15-2)22(7)19(3)4/h14-15,22-23,25-27,29H,1-3,5-6,16-18H2,4,7-13H3/t22-,23-,25?,26+,27+,29-/m0/s1 |
| InChIKey | MMRQFGBZRWZGAV-UOVNRQDUSA-N |
| XLogP | 7.13 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.80 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|