C29H48O6Si — CID 134952855
methyl (4S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R)-3-[(3E,5R,6S)-5-hydroxy-6,7-dimethyl-2-methylideneocta-3,7-dienyl]oxiran-2-yl]-4-methyl-5-methylidene-3-oxoheptanoate (PubChem CID 134952855) has the molecular formula C29H48O6Si and a molecular weight of 520.78 g/mol. Its IUPAC name is methyl (4S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R)-3-[(3E,5R,6S)-5-hydroxy-6,7-dimethyl-2-methylideneocta-3,7-dienyl]oxiran-2-yl]-4-methyl-5-methylidene-3-oxoheptanoate.
| Compound Name | methyl (4S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R)-3-[(3E,5R,6S)-5-hydroxy-6,7-dimethyl-2-methylideneocta-3,7-dienyl]oxiran-2-yl]-4-methyl-5-methylidene-3-oxoheptanoate |
|---|---|
| PubChem CID | 134952855 |
| Molecular Formula | C29H48O6Si |
| Molecular Weight | 520.78 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | methyl (4S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R)-3-[(3E,5R,6S)-5-hydroxy-6,7-dimethyl-2-methylideneocta-3,7-dienyl]oxiran-2-yl]-4-methyl-5-methylidene-3-oxoheptanoate |
| SMILES | C=C(/C=C/[C@@H](O)[C@@H](C)C(=C)C)C[C@H]1O[C@@H]1[C@@H](CC(=C)[C@H](C)C(=O)CC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H48O6Si/c1-18(2)21(5)23(30)14-13-19(3)15-25-28(34-25)26(35-36(11,12)29(7,8)9)16-20(4)22(6)24(31)17-27(32)33-10/h13-14,21-23,25-26,28,30H,1,3-4,15-17H2,2,5-12H3/b14-13+/t21-,22-,23+,25+,26+,28-/m0/s1 |
| InChIKey | DJMJZZYFLFWALD-TVPRYKLJSA-N |
| XLogP | 5.93 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.78 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|