C28H44O5Si — CID 11113710
(1S,4E,6S,11R,14S,15R)-14-[tert-butyl(dimethyl)silyl]oxy-11-methyl-6-[(2R)-3-methylbut-3-en-2-yl]-3,12-dimethylidene-7,16-dioxabicyclo[13.1.0]hexadec-4-ene-8,10-dione (PubChem CID 11113710) has the molecular formula C28H44O5Si and a molecular weight of 488.74 g/mol. Its IUPAC name is (1S,4E,6S,11R,14S,15R)-14-[tert-butyl(dimethyl)silyl]oxy-11-methyl-6-[(2R)-3-methylbut-3-en-2-yl]-3,12-dimethylidene-7,16-dioxabicyclo[13.1.0]hexadec-4-ene-8,10-dione.
| Compound Name | (1S,4E,6S,11R,14S,15R)-14-[tert-butyl(dimethyl)silyl]oxy-11-methyl-6-[(2R)-3-methylbut-3-en-2-yl]-3,12-dimethylidene-7,16-dioxabicyclo[13.1.0]hexadec-4-ene-8,10-dione |
|---|---|
| PubChem CID | 11113710 |
| Molecular Formula | C28H44O5Si |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | (1S,4E,6S,11R,14S,15R)-14-[tert-butyl(dimethyl)silyl]oxy-11-methyl-6-[(2R)-3-methylbut-3-en-2-yl]-3,12-dimethylidene-7,16-dioxabicyclo[13.1.0]hexadec-4-ene-8,10-dione |
| SMILES | C=C1/C=C/[C@@H]([C@H](C)C(=C)C)OC(=O)CC(=O)[C@H](C)C(=C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[C@H]2C1 |
| InChI | InChI=1S/C28H44O5Si/c1-17(2)20(5)23-13-12-18(3)14-24-27(32-24)25(33-34(10,11)28(7,8)9)15-19(4)21(6)22(29)16-26(30)31-23/h12-13,20-21,23-25,27H,1,3-4,14-16H2,2,5-11H3/b13-12+/t20-,21-,23+,24+,25+,27-/m1/s1 |
| InChIKey | ZEFHBWPPAHMQAO-BEQZYGASSA-N |
| XLogP | 6.33 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|