C29H54O6Si2 — CID 134841639
ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropyl]oxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate (PubChem CID 134841639) has the molecular formula C29H54O6Si2 and a molecular weight of 554.92 g/mol. Its IUPAC name is ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropyl]oxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropyl]oxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 134841639 |
| Molecular Formula | C29H54O6Si2 |
| Molecular Weight | 554.92 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropyl]oxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C/C(C)=C/[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1[C@@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H54O6Si2/c1-15-32-27(31)22(4)19-20(2)18-21(3)24(35-37(13,14)29(8,9)10)26-25(33-26)23(16-17-30)34-36(11,12)28(5,6)7/h17-19,21,23-26H,15-16H2,1-14H3/b20-18+,22-19+/t21-,23-,24+,25+,26-/m1/s1 |
| InChIKey | TZWPXWVPLIERIS-BFXJVEPLSA-N |
| XLogP | 7.22 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.92 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|