C28H44O5Si — CID 122227997
[(3R,4S)-4,5-dimethylhexa-1,5-dien-3-yl] (4S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-3-oxo-7-[(2S,3R)-3-prop-2-ynyloxiran-2-yl]heptanoate (PubChem CID 122227997) has the molecular formula C28H44O5Si and a molecular weight of 488.74 g/mol. Its IUPAC name is [(3R,4S)-4,5-dimethylhexa-1,5-dien-3-yl] (4S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-3-oxo-7-[(2S,3R)-3-prop-2-ynyloxiran-2-yl]heptanoate.
| Compound Name | [(3R,4S)-4,5-dimethylhexa-1,5-dien-3-yl] (4S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-3-oxo-7-[(2S,3R)-3-prop-2-ynyloxiran-2-yl]heptanoate |
|---|---|
| PubChem CID | 122227997 |
| Molecular Formula | C28H44O5Si |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | [(3R,4S)-4,5-dimethylhexa-1,5-dien-3-yl] (4S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-methylidene-3-oxo-7-[(2S,3R)-3-prop-2-ynyloxiran-2-yl]heptanoate |
| SMILES | C#CC[C@H]1O[C@@H]1[C@@H](CC(=C)[C@H](C)C(=O)CC(=O)O[C@H](C=C)[C@@H](C)C(=C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H44O5Si/c1-13-15-24-27(32-24)25(33-34(11,12)28(8,9)10)16-19(5)21(7)22(29)17-26(30)31-23(14-2)20(6)18(3)4/h1,14,20-21,23-25,27H,2-3,5,15-17H2,4,6-12H3/t20-,21-,23+,24+,25+,27-/m0/s1 |
| InChIKey | GONGBJXQFYJMFO-RTGXQPQESA-N |
| XLogP | 6.02 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|