C13H14FNO2 — CID 102584210
2-tert-butyl-4-fluoro-3-phenyl-1,2-oxazol-5-one (PubChem CID 102584210) has the molecular formula C13H14FNO2 and a molecular weight of 235.26 g/mol. Its IUPAC name is 2-tert-butyl-4-fluoro-3-phenyl-1,2-oxazol-5-one.
| Compound Name | 2-tert-butyl-4-fluoro-3-phenyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 102584210 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-tert-butyl-4-fluoro-3-phenyl-1,2-oxazol-5-one |
| SMILES | CC(C)(C)n1oc(=O)c(F)c1-c1ccccc1 |
| InChI | InChI=1S/C13H14FNO2/c1-13(2,3)15-11(10(14)12(16)17-15)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | MQYZFROMFMWEIP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |