C32H54N2O2Si5 — CID 102584278
[2,4-bis(4-methoxyphenyl)-6,9,9-tris(trimethylsilyl)-1,3-diaza-5-silaspiro[4.4]nona-1,3-dien-6-yl]-trimethylsilane (PubChem CID 102584278) has the molecular formula C32H54N2O2Si5 and a molecular weight of 639.23 g/mol. Its IUPAC name is [2,4-bis(4-methoxyphenyl)-6,9,9-tris(trimethylsilyl)-1,3-diaza-5-silaspiro[4.4]nona-1,3-dien-6-yl]-trimethylsilane.
| Compound Name | [2,4-bis(4-methoxyphenyl)-6,9,9-tris(trimethylsilyl)-1,3-diaza-5-silaspiro[4.4]nona-1,3-dien-6-yl]-trimethylsilane |
|---|---|
| PubChem CID | 102584278 |
| Molecular Formula | C32H54N2O2Si5 |
| Molecular Weight | 639.23 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | [2,4-bis(4-methoxyphenyl)-6,9,9-tris(trimethylsilyl)-1,3-diaza-5-silaspiro[4.4]nona-1,3-dien-6-yl]-trimethylsilane |
| SMILES | COc1ccc(C2=N[Si]3(C(c4ccc(OC)cc4)=N2)C([Si](C)(C)C)([Si](C)(C)C)CCC3([Si](C)(C)C)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C32H54N2O2Si5/c1-35-27-19-15-25(16-20-27)29-33-30(26-17-21-28(36-2)22-18-26)41(34-29)31(37(3,4)5,38(6,7)8)23-24-32(41,39(9,10)11)40(12,13)14/h15-22H,23-24H2,1-14H3 |
| InChIKey | YHIQNKYURVGJLD-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.23 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|