C11H11NO2 — CID 143124580
2-(4-methoxyphenyl)-5-methylidene-4H-1,3-oxazole (PubChem CID 143124580) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-methylidene-4H-1,3-oxazole.
| Compound Name | 2-(4-methoxyphenyl)-5-methylidene-4H-1,3-oxazole |
|---|---|
| PubChem CID | 143124580 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-methylidene-4H-1,3-oxazole |
| SMILES | C=C1CN=C(c2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C11H11NO2/c1-8-7-12-11(14-8)9-3-5-10(13-2)6-4-9/h3-6H,1,7H2,2H3 |
| InChIKey | IPMZRVQCEVXWCI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |