C11H11NO4 — CID 140703898
2-[4-(methoxymethoxy)phenyl]-4H-1,3-oxazol-5-one (PubChem CID 140703898) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-[4-(methoxymethoxy)phenyl]-4H-1,3-oxazol-5-one.
| Compound Name | 2-[4-(methoxymethoxy)phenyl]-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 140703898 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-[4-(methoxymethoxy)phenyl]-4H-1,3-oxazol-5-one |
| SMILES | COCOc1ccc(C2=NCC(=O)O2)cc1 |
| InChI | InChI=1S/C11H11NO4/c1-14-7-15-9-4-2-8(3-5-9)11-12-6-10(13)16-11/h2-5H,6-7H2,1H3 |
| InChIKey | VSRJMJNRHHGZCG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|