C11H9Cl3N2O3 — CID 58757884
2-[4-(methoxymethoxy)phenyl]-5-(trichloromethyl)-1,3,4-oxadiazole (PubChem CID 58757884) has the molecular formula C11H9Cl3N2O3 and a molecular weight of 323.56 g/mol. Its IUPAC name is 2-[4-(methoxymethoxy)phenyl]-5-(trichloromethyl)-1,3,4-oxadiazole.
| Compound Name | 2-[4-(methoxymethoxy)phenyl]-5-(trichloromethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 58757884 |
| Molecular Formula | C11H9Cl3N2O3 |
| Molecular Weight | 323.56 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | 2-[4-(methoxymethoxy)phenyl]-5-(trichloromethyl)-1,3,4-oxadiazole |
| SMILES | COCOc1ccc(-c2nnc(C(Cl)(Cl)Cl)o2)cc1 |
| InChI | InChI=1S/C11H9Cl3N2O3/c1-17-6-18-8-4-2-7(3-5-8)9-15-16-10(19-9)11(12,13)14/h2-5H,6H2,1H3 |
| InChIKey | WTUUKUUWBWEEKN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|