C26H28N2O5S — CID 102585000
2-[[7-(diethylamino)-2-oxo-3-[(E)-3-oxo-3-phenylprop-1-enyl]chromen-4-yl]amino]-4-sulfanylbutanoic acid (PubChem CID 102585000) has the molecular formula C26H28N2O5S and a molecular weight of 480.59 g/mol. Its IUPAC name is 2-[[7-(diethylamino)-2-oxo-3-[(E)-3-oxo-3-phenylprop-1-enyl]chromen-4-yl]amino]-4-sulfanylbutanoic acid.
| Compound Name | 2-[[7-(diethylamino)-2-oxo-3-[(E)-3-oxo-3-phenylprop-1-enyl]chromen-4-yl]amino]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 102585000 |
| Molecular Formula | C26H28N2O5S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 2-[[7-(diethylamino)-2-oxo-3-[(E)-3-oxo-3-phenylprop-1-enyl]chromen-4-yl]amino]-4-sulfanylbutanoic acid |
| SMILES | CCN(CC)c1ccc2c(NC(CCS)C(=O)O)c(/C=C/C(=O)c3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C26H28N2O5S/c1-3-28(4-2)18-10-11-19-23(16-18)33-26(32)20(24(19)27-21(14-15-34)25(30)31)12-13-22(29)17-8-6-5-7-9-17/h5-13,16,21,27,34H,3-4,14-15H2,1-2H3,(H,30,31)/b13-12+ |
| InChIKey | WMIRYHHDGKZAFV-OUKQBFOZSA-N |
| XLogP | 4.72 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|