C11H9F4NO — CID 102589072
3-fluoro-4-(4-methylphenyl)-3-(trifluoromethyl)azetidin-2-one (PubChem CID 102589072) has the molecular formula C11H9F4NO and a molecular weight of 247.19 g/mol. Its IUPAC name is 3-fluoro-4-(4-methylphenyl)-3-(trifluoromethyl)azetidin-2-one.
| Compound Name | 3-fluoro-4-(4-methylphenyl)-3-(trifluoromethyl)azetidin-2-one |
|---|---|
| PubChem CID | 102589072 |
| Molecular Formula | C11H9F4NO |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 3-fluoro-4-(4-methylphenyl)-3-(trifluoromethyl)azetidin-2-one |
| SMILES | Cc1ccc(C2NC(=O)C2(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F4NO/c1-6-2-4-7(5-3-6)8-10(12,9(17)16-8)11(13,14)15/h2-5,8H,1H3,(H,16,17) |
| InChIKey | CEWAYYAAUYNTFF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |