C19H35N3 — CID 102589569
(1S,2S,4R)-2-[(E,3S)-3-azido-3-methyloct-1-enyl]-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 102589569) has the molecular formula C19H35N3 and a molecular weight of 305.51 g/mol. Its IUPAC name is (1S,2S,4R)-2-[(E,3S)-3-azido-3-methyloct-1-enyl]-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2S,4R)-2-[(E,3S)-3-azido-3-methyloct-1-enyl]-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 102589569 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | (1S,2S,4R)-2-[(E,3S)-3-azido-3-methyloct-1-enyl]-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CCCCC[C@@](C)(/C=C/[C@@H]1C[C@H](C)CC[C@H]1C(C)C)N=[N+]=[N-] |
| InChI | InChI=1S/C19H35N3/c1-6-7-8-12-19(5,21-22-20)13-11-17-14-16(4)9-10-18(17)15(2)3/h11,13,15-18H,6-10,12,14H2,1-5H3/b13-11+/t16-,17-,18+,19+/m1/s1 |
| InChIKey | MVFUWJBTEJNEFF-IDAUYRIKSA-N |
| XLogP | 6.90 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|