C16H29N3 — CID 134984942
trans-(1S,4R)-2-[(E,3S)-3-azidohex-1-enyl]-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 134984942) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is trans-(1S,4R)-2-[(E,3S)-3-azidohex-1-enyl]-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | trans-(1S,4R)-2-[(E,3S)-3-azidohex-1-enyl]-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 134984942 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | trans-(1S,4R)-2-[(E,3S)-3-azidohex-1-enyl]-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CCC[C@@H](/C=C/C1C[C@H](C)CC[C@H]1C(C)C)N=[N+]=[N-] |
| InChI | InChI=1S/C16H29N3/c1-5-6-15(18-19-17)9-8-14-11-13(4)7-10-16(14)12(2)3/h8-9,12-16H,5-7,10-11H2,1-4H3/b9-8+/t13-,14?,15+,16+/m1/s1 |
| InChIKey | YWZQDAWXCMPQNV-WDBATGLQSA-N |
| XLogP | 5.73 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|