C16H27N3 — CID 102589571
(1S,2S,4R)-2-[(1E,3E,5R)-5-azidohexa-1,3-dienyl]-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 102589571) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is (1S,2S,4R)-2-[(1E,3E,5R)-5-azidohexa-1,3-dienyl]-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2S,4R)-2-[(1E,3E,5R)-5-azidohexa-1,3-dienyl]-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 102589571 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | (1S,2S,4R)-2-[(1E,3E,5R)-5-azidohexa-1,3-dienyl]-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1/C=C/C=C/[C@@H](C)N=[N+]=[N-] |
| InChI | InChI=1S/C16H27N3/c1-12(2)16-10-9-13(3)11-15(16)8-6-5-7-14(4)18-19-17/h5-8,12-16H,9-11H2,1-4H3/b7-5+,8-6+/t13-,14-,15-,16+/m1/s1 |
| InChIKey | CKAZGPOSOSUEIM-YVGZTKCISA-N |
| XLogP | 5.51 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|