C14H25N3 — CID 102589568
(1S,2S,4R)-2-[(E,3S)-3-azidobut-1-enyl]-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 102589568) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is (1S,2S,4R)-2-[(E,3S)-3-azidobut-1-enyl]-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2S,4R)-2-[(E,3S)-3-azidobut-1-enyl]-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 102589568 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | (1S,2S,4R)-2-[(E,3S)-3-azidobut-1-enyl]-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1/C=C/[C@H](C)N=[N+]=[N-] |
| InChI | InChI=1S/C14H25N3/c1-10(2)14-8-5-11(3)9-13(14)7-6-12(4)16-17-15/h6-7,10-14H,5,8-9H2,1-4H3/b7-6+/t11-,12+,13-,14+/m1/s1 |
| InChIKey | CYCCXKQTEFAQMI-VEWCADAXSA-N |
| XLogP | 4.95 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|