C12H18N2O2 — CID 102590140
(E)-3-[(1R,2R)-2-[(E)-3-amino-3-oxoprop-1-enyl]cyclohexyl]prop-2-enamide (PubChem CID 102590140) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (E)-3-[(1R,2R)-2-[(E)-3-amino-3-oxoprop-1-enyl]cyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-[(1R,2R)-2-[(E)-3-amino-3-oxoprop-1-enyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 102590140 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (E)-3-[(1R,2R)-2-[(E)-3-amino-3-oxoprop-1-enyl]cyclohexyl]prop-2-enamide |
| SMILES | NC(=O)/C=C/[C@H]1CCCC[C@@H]1/C=C/C(N)=O |
| InChI | InChI=1S/C12H18N2O2/c13-11(15)7-5-9-3-1-2-4-10(9)6-8-12(14)16/h5-10H,1-4H2,(H2,13,15)(H2,14,16)/b7-5+,8-6+/t9-,10-/m1/s1 |
| InChIKey | NKZZJMWKYFJCHN-PKVXPVJZSA-N |
| XLogP | 0.88 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|