C14H20O — CID 102595375
(1S,4R,5S,9R)-4-methyl-7-methylidenetricyclo[7.2.1.01,5]dodecan-12-one (PubChem CID 102595375) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (1S,4R,5S,9R)-4-methyl-7-methylidenetricyclo[7.2.1.01,5]dodecan-12-one.
| Compound Name | (1S,4R,5S,9R)-4-methyl-7-methylidenetricyclo[7.2.1.01,5]dodecan-12-one |
|---|---|
| PubChem CID | 102595375 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (1S,4R,5S,9R)-4-methyl-7-methylidenetricyclo[7.2.1.01,5]dodecan-12-one |
| SMILES | C=C1C[C@H]2CC[C@]3(CC[C@@H](C)[C@@H]3C1)C2=O |
| InChI | InChI=1S/C14H20O/c1-9-7-11-4-6-14(13(11)15)5-3-10(2)12(14)8-9/h10-12H,1,3-8H2,2H3/t10-,11-,12+,14+/m1/s1 |
| InChIKey | PAMOVERVZIWXLQ-NMKXLXIOSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|