C20H33NO5 — CID 102595505
methyl 12-[(1S,5S,7aS)-1-methyl-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-3-oxododecanoate (PubChem CID 102595505) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is methyl 12-[(1S,5S,7aS)-1-methyl-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-3-oxododecanoate.
| Compound Name | methyl 12-[(1S,5S,7aS)-1-methyl-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-3-oxododecanoate |
|---|---|
| PubChem CID | 102595505 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | methyl 12-[(1S,5S,7aS)-1-methyl-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-3-oxododecanoate |
| SMILES | COC(=O)CC(=O)CCCCCCCCC[C@H]1CC[C@H]2[C@H](C)OC(=O)N12 |
| InChI | InChI=1S/C20H33NO5/c1-15-18-13-12-16(21(18)20(24)26-15)10-8-6-4-3-5-7-9-11-17(22)14-19(23)25-2/h15-16,18H,3-14H2,1-2H3/t15-,16-,18-/m0/s1 |
| InChIKey | OPEGEKGOKMBSPV-BQFCYCMXSA-N |
| XLogP | 4.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|