C20H35NO5 — CID 102595506
methyl (10S)-12-[(1S,5R,7aS)-1-methyl-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-10-hydroxydodecanoate (PubChem CID 102595506) has the molecular formula C20H35NO5 and a molecular weight of 369.50 g/mol. Its IUPAC name is methyl (10S)-12-[(1S,5R,7aS)-1-methyl-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-10-hydroxydodecanoate.
| Compound Name | methyl (10S)-12-[(1S,5R,7aS)-1-methyl-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-10-hydroxydodecanoate |
|---|---|
| PubChem CID | 102595506 |
| Molecular Formula | C20H35NO5 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | methyl (10S)-12-[(1S,5R,7aS)-1-methyl-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-10-hydroxydodecanoate |
| SMILES | COC(=O)CCCCCCCC[C@H](O)CC[C@H]1CC[C@H]2[C@H](C)OC(=O)N12 |
| InChI | InChI=1S/C20H35NO5/c1-15-18-14-12-16(21(18)20(24)26-15)11-13-17(22)9-7-5-3-4-6-8-10-19(23)25-2/h15-18,22H,3-14H2,1-2H3/t15-,16-,17-,18-/m0/s1 |
| InChIKey | NYLVJWAVIRHFLS-XSLAGTTESA-N |
| XLogP | 3.79 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|