C13H19NO5 — CID 134853328
methyl 5-[(1S,5R,7aS)-1-methyl-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-3-oxopentanoate (PubChem CID 134853328) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 5-[(1S,5R,7aS)-1-methyl-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-3-oxopentanoate.
| Compound Name | methyl 5-[(1S,5R,7aS)-1-methyl-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-3-oxopentanoate |
|---|---|
| PubChem CID | 134853328 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | methyl 5-[(1S,5R,7aS)-1-methyl-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-3-oxopentanoate |
| SMILES | COC(=O)CC(=O)CC[C@H]1CC[C@H]2[C@H](C)OC(=O)N12 |
| InChI | InChI=1S/C13H19NO5/c1-8-11-6-4-9(14(11)13(17)19-8)3-5-10(15)7-12(16)18-2/h8-9,11H,3-7H2,1-2H3/t8-,9-,11-/m0/s1 |
| InChIKey | XXYDXCFDRRNDPG-QXEWZRGKSA-N |
| XLogP | 1.27 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|