C14H17N3O4 — CID 102596919
5-[dimethylamino-(pyridin-4-ylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 102596919) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 5-[dimethylamino-(pyridin-4-ylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[dimethylamino-(pyridin-4-ylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 102596919 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 5-[dimethylamino-(pyridin-4-ylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CN(C)C(Nc1ccncc1)=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C14H17N3O4/c1-14(2)20-12(18)10(13(19)21-14)11(17(3)4)16-9-5-7-15-8-6-9/h5-8H,1-4H3,(H,15,16) |
| InChIKey | KQSNJWFVQINHKY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|