About CID 102597538
CID 102597538 (PubChem CID 102597538) has the molecular formula C14H12N2O4+
and a molecular weight of 272.26 g/mol.
Molecular Properties
| Compound Name | CID 102597538 |
| PubChem CID | 102597538 |
| Molecular Formula | C14H12N2O4+ |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])c1ccc(C(=[O+])ONCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H12N2O4/c17-14(12-6-8-13(9-7-12)16(18)19)20-15-10-11-4-2-1-3-5-11/h1-9,15H,10H2/q+1 |
| InChIKey | AYKIGWRBTSKFBB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 102597538 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102597538?
The IUPAC name of CID 102597538 (CID 102597538) is not available.
What is the SMILES notation for CID 102597538?
The canonical SMILES for CID 102597538 is O=[N+]([O-])c1ccc(C(=[O+])ONCc2ccccc2)cc1.
What is the InChIKey of CID 102597538?
The InChIKey is AYKIGWRBTSKFBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O4/c17-14(12-6-8-13(9-7-12)16(18)19)20-15-10-11-4-2-1-3-5-11/h1-9,15H,10H2/q+1.
What are the key properties of CID 102597538?
CID 102597538 has a molecular weight of 272.26 g/mol, XLogP of 2.46, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102597538 is sourced from PubChem (CID 102597538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).