C10H20N4 — CID 102597896
N,1-ditert-butyl-1,2,4-triazol-3-amine (PubChem CID 102597896) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is N,1-ditert-butyl-1,2,4-triazol-3-amine.
| Compound Name | N,1-ditert-butyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 102597896 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | N,1-ditert-butyl-1,2,4-triazol-3-amine |
| SMILES | CC(C)(C)Nc1ncn(C(C)(C)C)n1 |
| InChI | InChI=1S/C10H20N4/c1-9(2,3)12-8-11-7-14(13-8)10(4,5)6/h7H,1-6H3,(H,12,13) |
| InChIKey | LEPIZVVDXYHZNP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |