C25H41N3Na2O12 — CID 102597953
disodium;N'-[(2R)-1-[[(1S)-1,3-dicarboxypropyl]amino]-1-oxodecan-2-yl]-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butanediimidate (PubChem CID 102597953) has the molecular formula C25H41N3Na2O12 and a molecular weight of 621.59 g/mol. Its IUPAC name is disodium;N'-[(2R)-1-[[(1S)-1,3-dicarboxypropyl]amino]-1-oxodecan-2-yl]-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butanediimidate.
| Compound Name | disodium;N'-[(2R)-1-[[(1S)-1,3-dicarboxypropyl]amino]-1-oxodecan-2-yl]-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butanediimidate |
|---|---|
| PubChem CID | 102597953 |
| Molecular Formula | C25H41N3Na2O12 |
| Molecular Weight | 621.59 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | disodium;N'-[(2R)-1-[[(1S)-1,3-dicarboxypropyl]amino]-1-oxodecan-2-yl]-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butanediimidate |
| SMILES | CCCCCCCC[C@@H](/N=C(\[O-])CCC([O-])=N[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(=O)N[C@@H](CCC(=O)O)C(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C25H43N3O12.2Na/c1-2-3-4-5-6-7-8-14(23(37)27-15(25(38)39)9-12-19(32)33)26-17(30)10-11-18(31)28-24-22(36)21(35)20(34)16(13-29)40-24;;/h14-16,20-22,24,29,34-36H,2-13H2,1H3,(H,26,30)(H,27,37)(H,28,31)(H,32,33)(H,38,39);;/q;2*+1/p-2/t14-,15+,16-,20-,21+,22-,24-;;/m1../s1 |
| InChIKey | OTBIAABUDAKGJX-VEGRMNQXSA-L |
| XLogP | -8.35 |
| TPSA | 264.69 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.59 |
| LogP ≤ 5 | -8.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|