C23H25NO2 — CID 102598648
(4R,5S)-3-oct-1-ynyl-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 102598648) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (4R,5S)-3-oct-1-ynyl-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-oct-1-ynyl-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102598648 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (4R,5S)-3-oct-1-ynyl-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCCC#CN1C(=O)O[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H25NO2/c1-2-3-4-5-6-13-18-24-21(19-14-9-7-10-15-19)22(26-23(24)25)20-16-11-8-12-17-20/h7-12,14-17,21-22H,2-6H2,1H3/t21-,22+/m1/s1 |
| InChIKey | MCPIIMNZXRKFGW-YADHBBJMSA-N |
| XLogP | 5.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|